CAS 6633-36-9

3,5-diamino-4-methylbenzoic acid

Description:

3,5-Diamino-4-methylbenzoic acid, also known by its CAS number 6633-36-9, is an organic compound characterized by the presence of two amino groups and a carboxylic acid group attached to a methyl-substituted benzene ring. This compound features a benzene ring with a methyl group at the para position relative to the carboxylic acid group, and amino groups at the meta positions. It is typically a solid at room temperature and is soluble in water due to the polar nature of its functional groups. The presence of multiple amino groups makes it a potential candidate for various applications, including in the synthesis of dyes, pharmaceuticals, and as a building block in organic synthesis. Additionally, its structural characteristics may impart specific biological activities, making it of interest in medicinal chemistry. The compound's reactivity is influenced by the amino and carboxylic acid functionalities, allowing for various chemical transformations. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1/C8H10N2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,9-10H2,1H3,(H,11,12)

SMILES: Cc1c(cc(cc1N)C(=O)O)N

3,5-Diamino-4-methylbenzoic acid

CAS: 6633-36-9

Formula: C₈H₁₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 166.1772

Ref: IN-DA006NBQ

3,5-Diamino-4-methylbenzoic acid

CAS: 6633-36-9

3,5-Diamino-4-methylbenzoic acid

Purity: 95%

Molecular weight: 166.18g/mol

Ref: 54-OR1054121

3,5-DIAMINO-4-METHYLBENZOIC ACID

CAS: 6633-36-9

Formula: C₈H₁₀N₂O₂

Purity: ≥97%

Color and Shape: Liquid, No data available.

Molecular weight: 166.18

Ref: 10-F470771

3,5-Diamino-4-methylbenzoic acid

CAS: 6633-36-9

3,5-Diamino-4-methylbenzoic acid is a chemical compound with the formula C6H3N3O2. It is an organic nitrite that reacts readily with nucleophiles such as alcohols, phenols, and amines to form the corresponding N-substituted benzoic acid. The reaction proceeds via a two step process in which 3,5-diamino-4-methylbenzoic acid first reacts with sodium nitrite to produce 3,5-diamino-4-nitrobenzoic acid followed by hydrolysis of this intermediate to form the desired product. Nitrite salts are used in the food industry as preservatives and antimicrobials. They can be applied as a gas or dissolved in water. Nitrite salts are also used for wastewater treatment and for environmental remediation.

Formula: C₈H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 166.18 g/mol

Ref: 3D-GAA63336