CymitQuimica logo

CAS 66332-77-2

:

2-Methoxyphenyl α-methyl-4-(2-methylpropyl)benzeneacetate

Description:
2-Methoxyphenyl α-methyl-4-(2-methylpropyl)benzeneacetate, with the CAS number 66332-77-2, is an organic compound characterized by its complex structure, which includes a methoxy group, an α-methyl group, and a branched alkyl chain. This compound typically exhibits properties associated with esters, such as being relatively non-polar, which influences its solubility in organic solvents while being less soluble in water. The presence of the methoxy group can enhance its reactivity and may contribute to its aromatic characteristics, making it potentially useful in various chemical applications, including as a fragrance or flavoring agent. Additionally, the branched alkyl chain may impart unique physical properties, such as lower volatility compared to straight-chain analogs. The compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound's unique structure suggests a range of potential applications in organic synthesis and industrial chemistry.
Formula:C20H24O3
InChI:InChI=1S/C20H24O3/c1-14(2)13-16-9-11-17(12-10-16)15(3)20(21)23-19-8-6-5-7-18(19)22-4/h5-12,14-15H,13H2,1-4H3
InChI key:InChIKey=FVRWRGBTEHAPDI-UHFFFAOYSA-N
SMILES:O(C(C(C)C1=CC=C(CC(C)C)C=C1)=O)C2=C(OC)C=CC=C2
Synonyms:
  • AF 2259
  • 2-Methoxyphenyl α-methyl-4-(2-methylpropyl)benzeneacetate
  • Benzeneacetic acid, α-methyl-4-(2-methylpropyl)-, 2-methoxyphenyl ester
  • Metoxibutropate
  • Ibuprofen guaiacol ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.