CAS 66347-27-1
:4-nitrophenyl 2-O-(6-deoxyhexopyranosyl)hexopyranoside
Description:
4-Nitrophenyl 2-O-(6-deoxyhexopyranosyl)hexopyranoside is a glycoside compound characterized by the presence of a nitrophenyl group and a sugar moiety. The structure features a 4-nitrophenyl group, which is known for its electron-withdrawing properties due to the nitro group, enhancing the compound's reactivity in various chemical reactions. The glycosidic bond connects the phenyl group to a hexopyranoside sugar, specifically modified with a 6-deoxyhexopyranosyl unit, indicating the absence of a hydroxyl group at the sixth carbon of the sugar ring. This modification can influence the compound's solubility, stability, and biological activity. The compound may exhibit specific optical properties and can be utilized in biochemical assays, particularly in studies involving glycosylation processes or as a substrate for glycosidase enzymes. Its CAS number, 66347-27-1, allows for precise identification in chemical databases and literature. Overall, this compound is of interest in both synthetic chemistry and potential applications in medicinal chemistry due to its unique structural features.
Formula:C18H25NO12
InChI:InChI=1/C18H25NO12/c1-7-11(21)13(23)15(25)17(28-7)31-16-14(24)12(22)10(6-20)30-18(16)29-9-4-2-8(3-5-9)19(26)27/h2-5,7,10-18,20-25H,6H2,1H3
Synonyms:- beta-D-Galactopyranoside, 4-nitrophenyl 2-O-(6-deoxy-alpha-L-galactopyranosyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
p-Nitrophenyl 2-O-(alpha-L-fucopyranosyl)-beta-D-galactopyranoside
CAS:Controlled ProductApplications A synthetic chromogenic substrate for the assay of a-fucosidases.
References DiCioccio, R.A., et al.: Anal. Biochem., 11, 176 (1981)Formula:C18H25NO12Color and Shape:NeatMolecular weight:447.394-Nitrophenyl 2-O-(α-L-fucopyranosyl)-β-D-galactopyranoside
CAS:4-Nitrophenyl 2-O-(α-L-fucopyranosyl)-β-D-galactopyranoside is a chromogenic enzymatic substrate for the detection and quantification of glycosidases, such as fucosidases and galactosidases. Upon enzymatic cleavage, the substrate releases the p-nitrophenol chromophore, which can be quantified via colorimetric analysis. This pNP-conjugated compound enables the rapid, sensitive, and high-throughput detection of enzyme activity in various applications, including enzymatic assays, inhibitor screening, and mechanistic studies. Its precise specificity for α-L-fucopyranosyl and β-D-galactopyranoside moieties makes it an excellent tool for advancing research in glycobiology and related fields.Formula:C18H25NO12Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:447.39 g/mol


