CAS 66347-68-0
:cyclohexane-1,2-diyldimethanediyl dimethanesulfonate
Description:
Cyclohexane-1,2-diyldimethanediyl dimethanesulfonate, with the CAS number 66347-68-0, is a chemical compound characterized by its unique structure, which includes a cyclohexane ring and multiple sulfonate groups. This compound typically exhibits properties associated with sulfonates, such as high solubility in polar solvents and potential applications in various chemical processes. The presence of dimethanesulfonate groups suggests that it may have surfactant properties, making it useful in formulations that require emulsification or dispersion. Additionally, the cyclohexane backbone contributes to its stability and hydrophobic characteristics, which can influence its behavior in different environments. The compound may also be of interest in organic synthesis and materials science due to its functional groups, which can participate in further chemical reactions. Overall, cyclohexane-1,2-diyldimethanediyl dimethanesulfonate is a versatile compound with potential applications in various fields, including pharmaceuticals, agrochemicals, and polymer chemistry.
Formula:C10H20O6S2
InChI:InChI=1/C10H20O6S2/c1-17(11,12)15-7-9-5-3-4-6-10(9)8-16-18(2,13)14/h9-10H,3-8H2,1-2H3
SMILES:CS(=O)(=O)OCC1CCCCC1COS(=O)(=O)C
Synonyms:- Cis-1,2-Bis(methanesulfonyloxymethyl)cyclohexane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
cyclohexane-1,2-diyldimethanediyl dimethanesulfonate
CAS:Formula:C10H20O6S2Purity:95%Color and Shape:SolidMolecular weight:300.3922cis-Cyclohexane-1,2-dimethanol Dimethanesulfonate
CAS:Controlled ProductApplications cis-Cyclohexane-1,2-dimethanol Dimethanesulfonate is used for the study of comparison of different busulfan analogs for depletion of hematopoietic stem cells and promotion of donor-type chimerism in murine bone marrow transplant recipients.
References Westerhof, G. R., et al.: Cancer Res. 60, 5470 (2000)Formula:C10H20O6S2Color and Shape:NeatMolecular weight:300.38Cyclohexane-1,2-diyldimethanediyl dimethanesulfonate
CAS:Please enquire for more information about Cyclohexane-1,2-diyldimethanediyl dimethanesulfonate including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C10H20O6S2Purity:Min. 95%Molecular weight:300.4 g/mol




