CymitQuimica logo

CAS 6635-31-0

:

6-hydroxy-5-nitronicotinic acid

Description:
6-Hydroxy-5-nitronicotinic acid, with the CAS number 6635-31-0, is a derivative of nicotinic acid featuring a hydroxyl group and a nitro group at specific positions on the pyridine ring. This compound is characterized by its acidic properties due to the carboxylic acid functional group, which can participate in proton transfer reactions. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the nitro group can enhance its reactivity and influence its electronic properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with potential therapeutic effects. Its solubility in polar solvents is typical for carboxylic acids, and it may undergo various chemical reactions, including esterification and nitration. Overall, 6-hydroxy-5-nitronicotinic acid is a notable compound in organic chemistry with potential applications in medicinal chemistry and related fields.
Formula:C6H4N2O5
InChI:InChI=1S/C6H4N2O5/c9-5-4(8(12)13)1-3(2-7-5)6(10)11/h1-2H,(H,7,9)(H,10,11)
InChI key:VJMXJGVEVASJOD-UHFFFAOYSA-N
SMILES:C1=C(C(=O)NC=C1C(=O)O)[N+](=O)[O-]
Synonyms:
  • 5-Carboxy-3-Nitro-2(1H)-Pyridinone
Found 7 products.