CAS 66354-88-9

1H-Indole, 7-methoxy-2-phenyl-

Description:

1H-Indole, 7-methoxy-2-phenyl- (CAS 66354-88-9) is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methoxy group at the 7-position and a phenyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. The methoxy group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological targets. Additionally, 1H-Indole derivatives are often studied for their role in various chemical reactions, including those involving electrophilic substitutions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₅H₁₃NO

InChI: InChI=1S/C15H13NO/c1-17-14-9-5-8-12-10-13(16-15(12)14)11-6-3-2-4-7-11/h2-10,16H,1H3

InChI key: InChIKey=CUBOZKCOLUQJMH-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C=C(N2)C3=CC=CC=C3)=CC=C1

Synonyms:

• Indole, 7-methoxy-2-phenyl-
• 1H-Indole, 7-methoxy-2-phenyl-
• 7-Methoxy-2-phenyl-1H-indole

7-Methoxy-2-phenyl-1H-indole

CAS: 66354-88-9

Formula: C₁₅H₁₃NO

Molecular weight: 223.2698

Ref: IN-DA00FXC4

7-Methoxy-2-phenyl-1H-indole

CAS: 66354-88-9

Versatile small molecule scaffold

Formula: C₁₅H₁₃NO

Purity: Min. 95%

Molecular weight: 223.27 g/mol

Ref: 3D-RCA35488