CAS 66357-17-3

1-cyano-3-{2-[({5-[(dimethylamino)methyl]furan-2-yl}methyl)sulfanyl]ethyl}-2-methylguanidine

Description:

1-Cyano-3-{2-[({5-[(dimethylamino)methyl]furan-2-yl}methyl)sulfanyl]ethyl}-2-methylguanidine, with the CAS number 66357-17-3, is a synthetic organic compound characterized by its complex structure, which includes a guanidine core, a cyano group, and a furan moiety. This compound features a dimethylamino group that enhances its solubility and potential biological activity. The presence of a sulfanyl group suggests possible reactivity and interactions with other chemical species, which may be relevant in medicinal chemistry. The furan ring contributes to the compound's aromatic character, potentially influencing its electronic properties and reactivity. Additionally, the guanidine structure is known for its basicity and ability to form hydrogen bonds, which can be significant in biological systems. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development and related fields. However, specific biological activities and applications would require empirical studies to elucidate its potential uses.

Formula: C₁₃H₂₁N₅OS

InChI: InChI=1/C13H21N5OS/c1-15-13(17-10-14)16-6-7-20-9-12-5-4-11(19-12)8-18(2)3/h4-5H,6-9H2,1-3H3,(H2,15,16,17)

AH 18801

CAS: 66357-17-3

AH 18801 is a biochemical.

Formula: C₁₃H₂₁N₅OS

Color and Shape: Solid

Molecular weight: 295.40

Ref: TM-T29733