CAS 66357-40-2
:2-(Nitromethylene)thiazolidine
Description:
2-(Nitromethylene)thiazolidine is a heterocyclic organic compound characterized by the presence of a thiazolidine ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The nitromethylene group (-C(NO2)=CH2) is attached to the thiazolidine structure, contributing to its reactivity and potential applications in organic synthesis. This compound typically exhibits properties such as being a solid at room temperature, with a specific melting point and solubility characteristics that depend on the solvent used. The presence of the nitro group often imparts polar characteristics, influencing its interactions with other chemical species. Additionally, 2-(Nitromethylene)thiazolidine may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis usually involves the reaction of thiazolidine derivatives with nitroalkenes or related compounds. As with many nitro-containing compounds, it is essential to handle this substance with care due to potential toxicity and reactivity.
Formula:C4H6N2O2S
InChI:InChI=1/C4H6N2O2S/c7-6(8)3-4-5-1-2-9-4/h3,5H,1-2H2/b4-3+
Synonyms:- 2-Nitromethylenethiazolidine
- (2E)-2-(nitromethylidene)-1,3-thiazolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
