CAS 66358-23-4

Imidazo[1,2-a]pyridin-5-amine

Description:

Imidazo[1,2-a]pyridin-5-amine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a molecular formula that includes nitrogen and carbon atoms, reflecting its aromatic nature and potential for various chemical interactions. It is often recognized for its role in medicinal chemistry, particularly as a scaffold in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of the amino group at the 5-position enhances its reactivity and solubility in polar solvents, making it suitable for various synthetic applications. Additionally, imidazo[1,2-a]pyridin-5-amine may exhibit biological activities, including antimicrobial and anticancer properties, which are of significant interest in drug discovery. Its structural features allow for potential modifications that can lead to the development of more potent derivatives. Overall, this compound serves as an important building block in the synthesis of more complex molecules in both academic and industrial research settings.

Formula: C₇H₇N₃

InChI: InChI=1/C7H7N3/c8-6-2-1-3-7-9-4-5-10(6)7/h1-5H,8H2

SMILES: c1cc(N)n2ccnc2c1

Synonyms:

• Imidazo[1,2-A]Pyridin-5-Ylamine

Imidazo[1,2-a]pyridin-5-amine

CAS: 66358-23-4

Imidazo[1,2-a]pyridin-5-amine

Purity: 98%

Molecular weight: 133.15g/mol

Ref: 54-OR903639

Imidazo[1,2-a]pyridin-5-amine

CAS: 66358-23-4

Formula: C₇H₇N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 133.154

Ref: 10-F077365

Imidazo[1,2-a]pyridin-5-ylamine

CAS: 66358-23-4

Versatile small molecule scaffold

Formula: C₇H₇N₃

Purity: Min. 95%

Molecular weight: 133.15 g/mol

Ref: 3D-RCA35823