CymitQuimica logo

CAS 66367-11-1

:

2(1H)-Quinoxalinone, 7-fluoro-3,4-dihydro-

Description:
2(1H)-Quinoxalinone, 7-fluoro-3,4-dihydro- is a chemical compound characterized by its bicyclic structure, which includes a quinoxalinone moiety. This compound features a fluorine atom at the 7-position, contributing to its unique chemical properties and potential biological activity. The presence of the dihydro group indicates that the compound has two hydrogen atoms added to the double bonds in the quinoxaline ring, which can influence its reactivity and stability. Typically, quinoxalinones are known for their diverse pharmacological activities, including antimicrobial and anticancer properties. The specific substitution of the fluorine atom can enhance lipophilicity and alter the compound's interaction with biological targets. This compound is of interest in medicinal chemistry and may be explored for its potential therapeutic applications. As with many chemical substances, safety and handling precautions are essential, and its use should be guided by appropriate regulatory standards.
Formula:C8H7FN2O
InChI:InChI=1S/C8H7FN2O/c9-5-1-2-6-7(3-5)11-8(12)4-10-6/h1-3,10H,4H2,(H,11,12)
InChI key:MKVHWJQPKMVYHA-UHFFFAOYSA-N
SMILES:C1C(=O)NC2=C(N1)C=CC(=C2)F
Synonyms:
  • 7-fluoro-3,4-dihydroquinoxalin-2(1H)-one
  • 2(1H)-Quinoxalinone, 7-fluoro-3,4-dihydro-
Found 6 products.