CymitQuimica logo

CAS 66373-26-0

:

Ethanone, 1-[4-methyl-2-(methylthio)-5-pyrimidinyl]-

Description:
Ethanone, 1-[4-methyl-2-(methylthio)-5-pyrimidinyl]- is an organic compound characterized by its pyrimidine ring structure, which is substituted with a methylthio group and a methyl group. This compound features a ketone functional group (ethanone) that contributes to its reactivity and potential applications in various chemical reactions. The presence of the pyrimidine moiety suggests potential biological activity, as pyrimidines are often found in pharmaceuticals and agrochemicals. The methylthio group can influence the compound's solubility and polarity, affecting its interaction with biological systems. Typically, compounds like this may exhibit properties such as moderate to high stability under standard conditions, but their reactivity can vary based on the surrounding environment and specific functional groups present. The compound's molecular structure allows for potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C8H10N2OS
InChI:InChI=1S/C8H10N2OS/c1-5-7(6(2)11)4-9-8(10-5)12-3/h4H,1-3H3
InChI key:SNNMYESMZCJSPK-UHFFFAOYSA-N
SMILES:CC1=NC(=NC=C1C(=O)C)SC
Found 3 products.