CymitQuimica logo

CAS 66375-96-0

:

N-[2-[4-[[[(Cyclohexylamino)carbonyl]amino]sulfonyl]phenyl]ethyl]-6-methyl-2-pyrazinecarboxamide

Description:
N-[2-[4-[[[(Cyclohexylamino)carbonyl]amino]sulfonyl]phenyl]ethyl]-6-methyl-2-pyrazinecarboxamide, with CAS number 66375-96-0, is a synthetic organic compound characterized by its complex structure, which includes a pyrazine ring, a sulfonamide group, and a cyclohexylamino moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity would depend on its interaction with biological targets. The presence of the pyrazine ring contributes to its aromatic character, which can influence solubility and reactivity. Additionally, the cyclohexyl group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological function. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further research in medicinal chemistry and drug development.
Formula:C21H27N5O4S
InChI:InChI=1S/C21H27N5O4S/c1-15-13-22-14-19(24-15)20(27)23-12-11-16-7-9-18(10-8-16)31(29,30)26-21(28)25-17-5-3-2-4-6-17/h7-10,13-14,17H,2-6,11-12H2,1H3,(H,23,27)(H2,25,26,28)
InChI key:InChIKey=UARTXGOLEHZWRF-UHFFFAOYSA-N
SMILES:S(NC(NC1CCCCC1)=O)(=O)(=O)C2=CC=C(CCNC(=O)C3=NC(C)=CN=C3)C=C2
Synonyms:
  • 2-Pyrazinecarboxamide, N-[2-[4-[[[(cyclohexylamino)carbonyl]amino]sulfonyl]phenyl]ethyl]-6-methyl-
  • N-[2-[4-[[[(Cyclohexylamino)carbonyl]amino]sulfonyl]phenyl]ethyl]-6-methyl-2-pyrazinecarboxamide
  • Pyrazinecarboxamide, N-[2-[4-[[[(cyclohexylamino)carbonyl]amino]sulfonyl]phenyl]ethyl]-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.