CAS 6638-24-0
:1-{[(4-methoxyphenyl)amino]methyl}naphthalen-2-ol
Description:
1-{[(4-methoxyphenyl)amino]methyl}naphthalen-2-ol, with the CAS number 6638-24-0, is an organic compound characterized by its complex structure, which includes a naphthalene core substituted with a hydroxyl group and an amino group linked to a methoxyphenyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential solubility in polar solvents due to the presence of the hydroxyl group. It may display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the methoxy group can influence its electronic properties and reactivity, potentially enhancing its lipophilicity. Additionally, the compound may participate in hydrogen bonding due to the hydroxyl group, affecting its interactions in biological systems. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various applications, including as a building block in organic synthesis or as a potential therapeutic agent.
Formula:C18H17NO2
InChI:InChI=1/C18H17NO2/c1-21-15-9-7-14(8-10-15)19-12-17-16-5-3-2-4-13(16)6-11-18(17)20/h2-11,19-20H,12H2,1H3
Synonyms:- 1-((4-methoxyanilino)methyl)-2-naphthol
- 2-(2,4-dichlorophenyl)-5-nitro-3H-benzoimidazole
- 2-Naphthalenol, 1-[[(4-methoxyphenyl)amino]methyl]-
- NSC47924
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-((4-Methoxyanilino)methyl)-2-naphthol
CAS:1-((4-Methoxyanilino)methyl)-2-naphthol is a research tool that can be used in the study of ion channels. It is a ligand for the receptor and an inhibitor for ion channels. It also binds to antibodies and has been shown to inhibit protein interactions. This product is not intended for use in humans or animals.
Formula:C18H17NO2Purity:Min. 95%Molecular weight:279.3 g/molNSC47924
CAS:NSC47924 is a laminin receptor (LR) inhibitor.Formula:C18H17NO2Purity:98%Color and Shape:SolidMolecular weight:279.33

