CAS 6639-43-6
:triphenylacetonitrile
Description:
Triphenylacetonitrile, with the CAS number 6639-43-6, is an organic compound characterized by its structure, which features a central acetonitrile group bonded to three phenyl groups. This compound is typically a white to light yellow solid at room temperature and is known for its relatively low solubility in water, but it is soluble in organic solvents such as ethanol, acetone, and chloroform. Triphenylacetonitrile is often utilized in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its chemical stability and ability to undergo various reactions, such as nucleophilic substitutions, make it a valuable compound in synthetic organic chemistry. Additionally, it exhibits properties typical of nitriles, including potential toxicity and the ability to participate in reactions that form new carbon-nitrogen bonds. As with many organic compounds, proper handling and safety precautions are essential due to its potential health hazards.
Formula:C20H15N
InChI:InChI=1/C20H15N/c21-16-20(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H
SMILES:c1ccc(cc1)C(C#N)(c1ccccc1)c1ccccc1
Synonyms:- Benzeneacetonitrile, Alpha,Alpha-Diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Triphenylacetonitrile
CAS:Controlled Product<p>Applications Triphenylacetonitrile is used as a reactant in the rhodium-catalyzed reductive cleavage of carbon-cyano bonds with hydrosilane.<br>References Tobisu, M., et al.: JACS., 131, 3174 (2009)<br></p>Formula:C20H15NColor and Shape:NeatMolecular weight:269.34


