CAS 6639-57-2

1,3-benzothiazole-2-carbaldehyde

Description:

1,3-Benzothiazole-2-carbaldehyde is an organic compound characterized by its fused benzothiazole ring structure, which incorporates both a benzene and a thiazole moiety. This compound features an aldehyde functional group at the 2-position of the benzothiazole ring, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a yellow to brown solid and is soluble in organic solvents such as ethanol and dichloromethane. The presence of the aldehyde group allows for various chemical transformations, making it useful in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Additionally, 1,3-benzothiazole derivatives are known for their biological activities, including antimicrobial and antifungal properties. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 1,3-benzothiazole-2-carbaldehyde is a valuable compound in both research and industrial applications due to its unique structural features and reactivity.

Formula: C₈H₅NOS

InChI: InChI=1/C8H5NOS/c10-5-8-9-6-3-1-2-4-7(6)11-8/h1-5H

SMILES: c1ccc2c(c1)nc(C=O)s2

Synonyms:

• Benzo[D]Thiazole-2-Carbaldehyde
• 2-Benzothiazolecarboxaldehyde

Benzothiazole-2-carboxaldehyde

CAS: 6639-57-2

Formula: C₈H₅NOS

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1964

Ref: IN-DA00FASN

1,3-Benzothiazole-2-carbaldehyde

CAS: 6639-57-2

Formula: C₈H₅NOS

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 163.19

Ref: 3B-B5403

1,3-Benzothiazole-2-carboxaldehyde

CAS: 6639-57-2

1,3-Benzothiazole-2-carboxaldehyde

Formula: C₈H₅NOS

Purity: 97%

Color and Shape: light yellow to yellow solid

Molecular weight: 163.20g/mol

Ref: 54-OR23088

1,3-Benzothiazole-2-carbaldehyde

CAS: 6639-57-2

Formula: C₈H₅NOS

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.19

Ref: 10-F033756