CAS 6639-87-8

6-nitrophthalazine

Description:

6-Nitrophthalazine is an organic compound characterized by its bicyclic structure, which consists of a phthalazine core with a nitro group positioned at the 6th carbon. This compound typically exhibits a pale yellow to orange crystalline appearance. It is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the nitro group introduces both electron-withdrawing characteristics and potential sites for further chemical reactions, making it a useful intermediate in organic synthesis. 6-Nitrophthalazine is often utilized in the development of dyes, pharmaceuticals, and agrochemicals due to its ability to participate in various chemical transformations. Additionally, it may exhibit specific solubility characteristics in organic solvents, which can influence its application in different chemical processes. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 6-nitrophthalazine serves as an important compound in both research and industrial applications.

Formula: C₁₈H₂₄N₄O₂

InChI: InChI=1/C8H5N3O2/c12-11(13)8-2-1-6-4-9-10-5-7(6)3-8/h1-5H

SMILES: c1cc(cc2cnncc12)N(=O)=O

Synonyms:

• 6-Nitroquinoxaline
• Quinoxaline, 6-nitro-
• Tcmdc-123943

6-nitroquinoxaline

CAS: 6639-87-8

Formula: C₈H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.1442

Ref: IN-DA003NBK

6-Nitroquinoxaline

CAS: 6639-87-8

6-Nitroquinoxaline

Formula: C₈H₅N₃O₂

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 175.14g/mol

Ref: 54-OR4401

6-Nitroquinoxaline

CAS: 6639-87-8

Formula: C₈H₅N₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 175.147

Ref: 10-F237077