CAS 663955-59-7

5-ethynyl-2-methoxypyridine

Description:

5-Ethynyl-2-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an ethynyl group (–C≡C–) at the 5-position and a methoxy group (–OCH₃) at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The ethynyl group can participate in various chemical reactions, including cross-coupling reactions, making it a versatile building block in organic synthesis. Additionally, the methoxy group can influence the compound's solubility and reactivity. As with many organic compounds, safety precautions should be taken when handling 5-ethynyl-2-methoxypyridine, as it may pose health risks if ingested or inhaled.

Formula: C₈H₇NO

InChI: InChI=1/C8H7NO/c1-3-7-4-5-8(10-2)9-6-7/h1,4-6H,2H3

SMILES: C#Cc1ccc(nc1)OC

Pyridine, 5-ethynyl-2-methoxy- (9CI)

CAS: 663955-59-7

Formula: C₈H₇NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 133.1473

Ref: IN-DA00FD5M

5-Ethynyl-2-methoxypyridine

CAS: 663955-59-7

5-Ethynyl-2-methoxypyridine

Purity: 95%

Molecular weight: 133.15g/mol

Ref: 54-OR917903

5-Ethynyl-2-methoxypyridine

CAS: 663955-59-7

Formula: C₈H₇NO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 133.15

Ref: 10-F235407

5-Ethynyl-2-methoxypyridine

CAS: 663955-59-7

5-Ethynyl-2-methoxypyridine is a drug with analgesic, marginally anti-inflammatory and anti-pyretic properties. It has been proposed to act as an inhibitor of prostaglandin synthesis. This compound is a weak base that is poorly soluble in water and slightly soluble in ethanol. It appears to have low oral bioavailability (less than 10%) but can be taken orally with minimal side effects because it does not cross the blood brain barrier or affect the central nervous system. 5-Ethynyl-2-methoxypyridine also has cyclic pharmacophore features that are similar to those found in aspirin and other drugs used for pain relief.

Formula: C₈H₇NO

Purity: Min. 95%

Molecular weight: 133.15 g/mol

Ref: 3D-NBB95559