
CAS 664-95-9
:Glycyclamide
Description:
Glycyclamide, with the CAS number 664-95-9, is an organic compound that belongs to the class of amides. It is characterized by the presence of both an amine and a carboxylic acid functional group, which contributes to its properties as a polar molecule. Glycyclamide is typically a white crystalline solid at room temperature and is soluble in water due to its ability to form hydrogen bonds. This compound is often studied for its potential applications in pharmaceuticals and biochemistry, particularly in relation to its role as a building block in the synthesis of various bioactive molecules. Its structure includes a glycine moiety, which is an amino acid, making it relevant in biological systems. Glycyclamide may exhibit various biological activities, and its interactions with other molecules can be influenced by factors such as pH and temperature. As with many chemical substances, safety and handling precautions should be observed, as it may have specific toxicity or reactivity profiles that require attention in laboratory settings.
Formula:C14H20N2O3S
InChI:InChI=1S/C14H20N2O3S/c1-11-7-9-13(10-8-11)20(18,19)16-14(17)15-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H2,15,16,17)
InChI key:InChIKey=RIGBPMDIGYBTBJ-UHFFFAOYSA-N
SMILES:S(NC(NC1CCCCC1)=O)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:- Urea, 1-cyclohexyl-3-(p-tolylsulfonyl)-
- Agliral
- K 386
- N-[(Cyclohexylamino)carbonyl]-4-methylbenzenesulfonamide
- Benzenesulfonamide, N-[(cyclohexylamino)carbonyl]-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glycyclamide
CAS:Glycolamide is a sulfonylurea compound containing cyclohexyl groups.Formula:C14H20N2O3SColor and Shape:SolidMolecular weight:296.39
