CAS 6640-55-7

2-methyl-1,2,3,4-tetrahydroquinoxaline

Description:

2-Methyl-1,2,3,4-tetrahydroquinoxaline is a bicyclic organic compound characterized by its fused ring structure, which consists of a quinoxaline framework with a methyl group at the 2-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential biological activity, including neuroprotective and anticonvulsant properties, making it of interest in medicinal chemistry. The presence of nitrogen atoms in the ring contributes to its basicity and reactivity, allowing it to participate in various chemical reactions, such as alkylation and acylation. Additionally, 2-methyl-1,2,3,4-tetrahydroquinoxaline may exhibit solubility in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. As with many nitrogen-containing heterocycles, it may also engage in hydrogen bonding, affecting its interactions in biological systems. Overall, this compound serves as a valuable scaffold in drug discovery and development.

Formula: C₉H₁₂N₂

InChI: InChI=1/C9H12N2/c1-7-6-10-8-4-2-3-5-9(8)11-7/h2-5,7,10-11H,6H2,1H3

SMILES: CC1CNc2ccccc2N1

2-Methyl-1,2,3,4-tetrahydroquinoxaline

CAS: 6640-55-7

Formula: C₉H₁₂N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 148.2050

Ref: IN-DA00FU2V

2-Methyl-1,2,3,4-tetrahydroquinoxaline

CAS: 6640-55-7

2-Methyl-1,2,3,4-tetrahydroquinoxaline

Purity: 98%

Molecular weight: 148.20g/mol

Ref: 54-OR77535

2-methyl-1,2,3,4-tetrahydroquinoxaline

CAS: 6640-55-7

Formula: C₉H₁₂N₂

Purity: 98%

Molecular weight: 148.209

Ref: 10-F526960

2-Methyl-1,2,3,4-tetrahydroquinoxaline

CAS: 6640-55-7

2-Methyl-1,2,3,4-tetrahydroquinoxaline is an enantioselective antioxidant that has been shown to have a chiral conformation. It has also been found to be a catalyst in the reductive elimination of hydrochloric acid. This compound can be hydrogenated by catalytic hydrogenation and this reaction produces tetralin as a by-product. 2-Methyl-1,2,3,4-tetrahydroquinoxaline is used in research because it contains a methyl group and amines that are important for biological functions.

Formula: C₉H₁₂N₂

Purity: Min. 95%

Molecular weight: 148.2 g/mol

Ref: 3D-GAA64055