CAS 6641-83-4

Methyllevulinicacid; 95%

Description:

Methyllevulinic acid, with the CAS number 6641-83-4, is an organic compound that belongs to the class of levulinic acid derivatives. It is characterized by its molecular structure, which includes a methyl group and a carboxylic acid functional group. This compound is typically a colorless to pale yellow liquid with a slightly sweet odor. Methyllevulinic acid is soluble in water and organic solvents, making it versatile for various applications. It is known for its potential as a platform chemical in the production of biofuels, biodegradable plastics, and other value-added chemicals. Additionally, it exhibits properties that may be beneficial in food and pharmaceutical industries due to its relatively low toxicity. The compound can be synthesized from biomass, highlighting its relevance in sustainable chemistry. Its reactivity allows it to participate in various chemical reactions, including esterification and transesterification, further expanding its utility in chemical synthesis and industrial applications.

Formula: C₆H₁₀O₃

InChI: InChI=1/C6H10O3/c1-4(6(8)9)3-5(2)7/h4H,3H2,1-2H3,(H,8,9)

SMILES: CC(CC(=O)C)C(=O)O

Synonyms:

• 2-Methyl-4-Oxopentanoic Acid

α-Methyllevulinic Acid

CAS: 6641-83-4

Formula: C₆H₁₀O₃

Purity: >98.0%(GC)

Color and Shape: Colorless to Light orange to Yellow clear liquid

Molecular weight: 130.14

Ref: 3B-M1058

α-Methyllevulinic Acid

CAS: 6641-83-4

Formula: C₆H₁₀O₃

Purity: 98%

Color and Shape: Liquid

Molecular weight: 130.1418

Ref: IN-DA003NSE

2-Methyl-4-oxopentanoic acid

CAS: 6641-83-4

2-Methyl-4-oxopentanoic acid

Purity: 95%

Molecular weight: 130.14g/mol

Ref: 54-OR1003403

2-Methyl-4-oxopentanoic acid

CAS: 6641-83-4

Formula: C₆H₁₀O₃

Purity: 98%

Molecular weight: 130.143

Ref: 10-F066644