CAS 66417-77-4
:4-(3-Pyridinyl)-3-buten-1-amine
Description:
4-(3-Pyridinyl)-3-buten-1-amine, with the CAS number 66417-77-4, is an organic compound characterized by its pyridine ring and an amine functional group. This compound features a butenyl chain, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the pyridine moiety suggests that it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its structure allows for potential interactions with biological targets, making it of interest in drug development and pharmacology. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its practical applications. Overall, 4-(3-Pyridinyl)-3-buten-1-amine is a versatile compound with potential implications in various fields, including organic synthesis and medicinal chemistry.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c10-6-2-1-4-9-5-3-7-11-8-9/h1,3-5,7-8H,2,6,10H2
InChI key:InChIKey=FFCHEUAKXIVHAD-UHFFFAOYSA-N
SMILES:C(=CCCN)C=1C=CC=NC1
Synonyms:- 4-(3-Pyridinyl)-3-buten-1-amine
- 3-Buten-1-amine, 4-(3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(3-Pyridinyl)-3-buten-1-amine
CAS:Controlled Product<p>Applications 4-(3-Pyridinyl)-3-buten-1-amine is a useful synthetic intermediate.<br></p>Formula:C9H12N2Color and Shape:NeatMolecular weight:197.66
