
CAS 66419-07-6
:(2α,3β,5α,7β,11α)-7,8-Epoxy-11,14-dihydroxy-2,3-[[(6S,7S,9R)-6-hydroxy-9-methyl-8-oxa-1-thia-4-azaspiro[4.5]dec-3-ene-6,7-diyl]bis(oxy)]-12-oxocard-20(22)-enolide
Description:
The chemical substance with the name "(2α,3β,5α,7β,11α)-7,8-Epoxy-11,14-dihydroxy-2,3-[[(6S,7S,9R)-6-hydroxy-9-methyl-8-oxa-1-thia-4-azaspiro[4.5]dec-3-ene-6,7-diyl]bis(oxy)]-12-oxocard-20(22)-enolide" and CAS number "66419-07-6" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as epoxy, hydroxyl, and ether linkages. This compound is notable for its stereochemistry, featuring several chiral centers that contribute to its potential biological activity. It belongs to a class of compounds known for their pharmacological properties, possibly exhibiting antimicrobial or anti-inflammatory effects. The presence of the oxocard and spirocyclic structures suggests that it may interact with biological targets in a unique manner, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, which are critical for its application in research or therapeutic contexts. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C31H39NO10S
InChI:InChI=1S/C31H39NO10S/c1-14-11-29(32-6-7-43-29)31(37)25(39-14)40-18-9-16-10-20-30(42-20)23(26(16,2)12-19(18)41-31)22(34)24(35)27(3)17(4-5-28(27,30)36)15-8-21(33)38-13-15/h6,8,14,16-20,22-23,25,34,36-37H,4-5,7,9-13H2,1-3H3
InChI key:InChIKey=BGKAKFOJZRBENJ-UHFFFAOYSA-N
SMILES:OC12C34C(C5(C)C(CC3O4)CC6C(C5)OC7(O)C(O6)OC(C)CC78N=CCS8)C(O)C(=O)C1(C)C(CC2)C9=CC(=O)OC9
Synonyms:- Card-20(22)-enolide, 7,8-epoxy-11,14-dihydroxy-2,3-[(6-hydroxy-9-methyl-8-oxa-1-thia-4-azaspiro[4.5]dec-3-ene-6,7-diyl)bis(oxy)]-12-oxo-, [2α(6S,7S,9R),3β,5α,7β,11α]-
- Card-20(22)-enolide, 7,8-epoxy-11,14-dihydroxy-2,3-[[(6S,7S,9R)-6-hydroxy-9-methyl-8-oxa-1-thia-4-azaspiro[4.5]dec-3-ene-6,7-diyl]bis(oxy)]-12-oxo-, (2α,3β,5α,7β,11α)-
- Labriformin
- (2α,3β,5α,7β,11α)-7,8-Epoxy-11,14-dihydroxy-2,3-[[(6S,7S,9R)-6-hydroxy-9-methyl-8-oxa-1-thia-4-azaspiro[4.5]dec-3-ene-6,7-diyl]bis(oxy)]-12-oxocard-20(22)-enolide
- Labriformine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Labriformine
CAS:<p>Labriformine is a nitrogen-containing cardenolide of low polarity, predominated in the latices.</p>Formula:C31H39NO10SColor and Shape:SolidMolecular weight:617.71
