
CAS 66419-08-7
:Card-20(22)-enolide, 7,8-epoxy-11,14-dihydroxy-12-oxo-2,3-[(tetrahydro-3-hydroxy-6-methyl-4-oxo-2H-pyran-3,2-diyl)bis(oxy)]-, (2α,2′S,3β,3′R,5α,6′R,7β,11α)-
Description:
Card-20(22)-enolide, with the CAS number 66419-08-7, is a complex organic compound characterized by its steroidal structure, which includes multiple functional groups such as hydroxyl (-OH) and carbonyl (C=O) groups, as well as an epoxy group. This compound features a unique arrangement of stereocenters, contributing to its specific three-dimensional conformation, which is crucial for its biological activity. The presence of a tetrahydro-3-hydroxy-6-methyl-4-oxo-2H-pyran moiety indicates that it has additional cyclic structures that may influence its reactivity and interactions with biological targets. Card-20(22)-enolide is likely to exhibit significant pharmacological properties, potentially acting as a bioactive agent in various biological systems. Its structural complexity suggests that it may participate in various chemical reactions, including those typical of steroid derivatives, such as oxidation and reduction processes. Overall, this compound represents a fascinating area of study within the field of natural products and medicinal chemistry, with potential applications in drug development and therapeutic interventions.
Formula:C29H36O11
InChI:InChI=1S/C29H36O11/c1-12-6-18(30)29(35)24(37-12)38-16-8-14-9-19-28(40-19)22(25(14,2)10-17(16)39-29)21(32)23(33)26(3)15(4-5-27(26,28)34)13-7-20(31)36-11-13/h7,12,14-17,19,21-22,24,32,34-35H,4-6,8-11H2,1-3H3
InChI key:InChIKey=WSTYKMSHUMUSAY-UHFFFAOYSA-N
SMILES:OC12C34C(C5(C)C(CC3O4)CC6C(C5)OC7(O)C(O6)OC(C)CC7=O)C(O)C(=O)C1(C)C(CC2)C8=CC(=O)OC8
Synonyms:- Card-20(22)-enolide, 7,8-epoxy-11,14-dihydroxy-12-oxo-2,3-[(tetrahydro-3-hydroxy-6-methyl-4-oxo-2H-pyran-3,2-diyl)bis(oxy)]-, [2α(2S,3R,6R),3β,5α,7β,11α]-
- Card-20(22)-enolide, 7,8-epoxy-11,14-dihydroxy-12-oxo-2,3-[(tetrahydro-3-hydroxy-6-methyl-4-oxo-2H-pyran-3,2-diyl)bis(oxy)]-, (2α,2′S,3β,3′R,5α,6′R,7β,11α)-
- Labriformidin
- 1H,11H-Cyclopenta[7,8]phenanthro[2,3-b]pyrano[3,2-e][1,4]dioxin, card-20(22)-enolide deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Labriformidin
CAS:<p>Labriformidin is a epoxy cardenolide.</p>Formula:C29H36O11Color and Shape:SolidMolecular weight:560.596
