CAS 6642-34-8

(6-bromo-1,3-benzodioxol-5-yl)methanol

Description:

(6-bromo-1,3-benzodioxol-5-yl)methanol, with the CAS number 6642-34-8, is a chemical compound characterized by its unique structure that includes a benzodioxole moiety and a hydroxymethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including potential solubility in organic solvents and moderate reactivity due to the presence of the bromine substituent. The bromine atom can influence the compound's reactivity, making it a potential candidate for further chemical transformations or reactions, such as nucleophilic substitutions. Additionally, the benzodioxole structure is known for its presence in various natural products and synthetic compounds, often contributing to biological activity. The hydroxymethyl group may also impart some degree of polarity, affecting the compound's interactions in biological systems. Overall, (6-bromo-1,3-benzodioxol-5-yl)methanol is of interest in organic synthesis and medicinal chemistry, where its unique structural features may be leveraged for developing new therapeutic agents or materials.

Formula: C₈H₇BrO₃

InChI: InChI=1/C8H7BrO3/c9-6-2-8-7(11-4-12-8)1-5(6)3-10/h1-2,10H,3-4H2

SMILES: c1c(CO)c(cc2c1OCO2)Br

Synonyms:

• 1,3-Benzodioxole-5-Methanol, 6-Bromo-

(6-Bromo-1,3-benzodioxol-5-yl)methanol

CAS: 6642-34-8

Formula: C₈H₇BrO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 231.0434

Ref: IN-DA00FA14

(6-Bromo-2H-1,3-benzodioxol-5-yl)methanol

CAS: 6642-34-8

(6-Bromo-2H-1,3-benzodioxol-5-yl)methanol

Purity: 95%

Molecular weight: 231.04g/mol

Ref: 54-OR32105

(6-Bromobenzo[d][1,3]dioxol-5-yl)methanol

CAS: 6642-34-8

Formula: C₈H₇BrO₃

Purity: 98%

Molecular weight: 231.045

Ref: 10-F216586

(6-Bromobenzo[d][1,3]dioxol-5-yl)methanol

CAS: 6642-34-8

Versatile small molecule scaffold

Formula: C₈H₇BrO₃

Purity: Min. 95%

Molecular weight: 231.04 g/mol

Ref: 3D-GAA64234