CymitQuimica logo

CAS 664364-47-0

:

3-Pyrrolidinol, 2-methyl-, hydrochloride (1:1), (2S,3R)-

Description:
3-Pyrrolidinol, 2-methyl-, hydrochloride (1:1), (2S,3R)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This specific compound is a hydrochloride salt, indicating that it is the hydrochloride form of 2-methyl-3-pyrrolidinol, which is a chiral molecule with specific stereochemistry denoted by the (2S,3R) configuration. The presence of the hydroxyl (-OH) group contributes to its solubility in water and potential for hydrogen bonding, while the methyl group at the 2-position influences its physical and chemical properties. As a hydrochloride, it typically appears as a white crystalline solid. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances.
Formula:C5H11NO·ClH
InChI:InChI=1S/C5H11NO.ClH/c1-4-5(7)2-3-6-4;/h4-7H,2-3H2,1H3;1H/t4-,5+;/m0./s1
InChI key:InChIKey=CFFLXBUMALVKSD-UYXJWNHNSA-N
SMILES:O[C@H]1[C@H](C)NCC1.Cl
Synonyms:
  • 3-Pyrrolidinol, 2-methyl-, hydrochloride, (2S,3R)-
  • 3-Pyrrolidinol, 2-methyl-, hydrochloride (1:1), (2S,3R)-
Found 3 products.