CAS 66469-86-1
:ethyl 2,5-dimethoxyphenylacetate
Description:
Ethyl 2,5-dimethoxyphenylacetate, with the CAS number 66469-86-1, is an organic compound characterized by its ester functional group, which is derived from the reaction of 2,5-dimethoxyphenylacetic acid and ethanol. This compound features a phenyl ring substituted with two methoxy groups at the 2 and 5 positions, enhancing its lipophilicity and potentially influencing its biological activity. Ethyl 2,5-dimethoxyphenylacetate is typically a colorless to pale yellow liquid with a pleasant, sweet aroma, making it of interest in the fragrance and flavor industries. Its molecular structure contributes to its solubility in organic solvents while being less soluble in water. The compound may exhibit various chemical properties, including reactivity under specific conditions, and it may participate in further chemical reactions such as hydrolysis or transesterification. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H16O4
InChI:InChI=1/C12H16O4/c1-4-16-12(13)8-9-7-10(14-2)5-6-11(9)15-3/h5-7H,4,8H2,1-3H3
SMILES:CCOC(=O)Cc1cc(ccc1OC)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2,5-dimethoxyphenylacetate
CAS:Formula:C12H16O4Purity:98%Color and Shape:LiquidMolecular weight:224.2530Ethyl 2,5-dimethoxyphenylacetate
CAS:Ethyl 2,5-dimethoxyphenylacetate is a chemical that has a wide range of uses in the synthesis of complex compounds. It can be used as an intermediate for the production of research chemicals or as a reaction component for speciality chemicals. The compound is also useful in the synthesis of fine chemicals and other useful scaffolds. It has been used as a building block to produce high-quality reagents.Formula:C12H16O4Purity:Min. 95%Color and Shape:PowderMolecular weight:224.25 g/molEthyl 2-(2,5-dimethoxyphenyl)acetate
CAS:Purity:98%Color and Shape:LiquidMolecular weight:224.2559967



