CAS 6647-95-6

4-Iodo-1,5-dimethyl-1H-pyrazole-3-carboxylic acid

Description:

4-Iodo-1,5-dimethyl-1H-pyrazole-3-carboxylic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of the iodo substituent at the 4-position and two methyl groups at the 1 and 5 positions contributes to its unique chemical properties. The carboxylic acid functional group at the 3-position enhances its acidity and reactivity, making it useful in various chemical reactions, including esterification and amidation. This compound is typically used in synthetic organic chemistry and may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological systems, which could be explored for medicinal applications. Additionally, the presence of iodine can impart specific properties such as increased lipophilicity and potential for radiolabeling in imaging studies. Overall, 4-Iodo-1,5-dimethyl-1H-pyrazole-3-carboxylic acid is a versatile compound with applications in both research and industry.

Formula: C₆H₇IN₂O₂

InChI: InChI=1S/C6H7IN2O2/c1-3-4(7)5(6(10)11)8-9(3)2/h1-2H3,(H,10,11)

InChI key: InChIKey=LLKCKWLAENNHOZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(I)=C(C)N(C)N1

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 4-iodo-1,5-dimethyl-
• 4-Iodo-1,5-dimethyl-1H-pyrazole-3-carboxylic acid
• Pyrazole-3-carboxylic acid, 4-iodo-1,5-dimethyl-

4-Iodo-1,5-dimethyl-1H-pyrazole-3-carboxylic acid

CAS: 6647-95-6

Versatile small molecule scaffold

Formula: C₆H₇IN₂O₂

Purity: Min. 95%

Molecular weight: 266.04 g/mol

Ref: 3D-GAA64795