CAS 66476-82-2
:tert-butyl 2-cyanopropanoate
Description:
Tert-butyl 2-cyanopropanoate, with the CAS number 66476-82-2, is an organic compound that belongs to the class of esters. It is characterized by its tert-butyl group, which contributes to its branched structure, enhancing its steric hindrance and influencing its reactivity. The compound features a cyano group (-CN) attached to a propanoate moiety, which imparts notable polarity and potential for nucleophilic reactions. Tert-butyl 2-cyanopropanoate is typically a colorless to pale yellow liquid with a fruity odor, making it appealing for various applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its relatively low boiling point and moderate solubility in organic solvents facilitate its use in chemical reactions. Additionally, the presence of the cyano group can enhance its reactivity in nucleophilic addition reactions, making it a valuable building block in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C8H13NO2
InChI:InChI=1/C8H13NO2/c1-6(5-9)7(10)11-8(2,3)4/h6H,1-4H3
SMILES:CC(C#N)C(=O)OC(C)(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
tert-Butyl 2-cyano-2-methylacetate
CAS:tert-Butyl 2-cyano-2-methylacetate is a nonpolar chemical that is used as an alkylating agent in organic chemistry. It is synthesized by the reaction of glyoxylate and imine, which forms an enantiomeric pair with opposite stereogenic properties. The compound can also be used in asymmetric synthesis to form enantiomerically pure products. This compound has been shown to have catalytic activity when dissolved in organic solvents. Tert-butyl 2-cyano-2-methylacetate is soluble in both polar and nonpolar solvents, making it suitable for use in a variety of reactions.
Formula:C8H13NO2Purity:Min. 95%Molecular weight:155.19 g/mol
