CAS 66495-88-3

3-hydroxy-2-methoxybenzaldehyde

Description:

3-Hydroxy-2-methoxybenzaldehyde, also known as o-vanillin, is an organic compound characterized by its aromatic structure featuring both hydroxyl and methoxy functional groups attached to a benzaldehyde moiety. This compound typically appears as a pale yellow to white crystalline solid and is soluble in organic solvents such as ethanol and ether, while being less soluble in water. Its molecular formula is C9H10O3, and it has a distinct sweet, vanilla-like aroma, which makes it of interest in flavoring and fragrance applications. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including oxidation and condensation. Additionally, 3-hydroxy-2-methoxybenzaldehyde exhibits antioxidant properties, which may have implications in food preservation and health-related applications. Its unique structural features and functional properties make it a valuable compound in both synthetic organic chemistry and industrial applications.

Formula: C₈H₈O₃

InChI: InChI=1/C8H8O3/c1-11-8-6(5-9)3-2-4-7(8)10/h2-5,10H,1H3

SMILES: COc1c(cccc1O)C=O

3-Hydroxy-2-methoxybenzaldehyde

CAS: 66495-88-3

Formula: C₈H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.1473

Ref: IN-DA00FDHX

3-Hydroxy-2-methoxybenzaldehyde

CAS: 66495-88-3

3-Hydroxy-2-methoxybenzaldehyde

Purity: 98%

Molecular weight: 152.15g/mol

Ref: 54-OR957483

3-Hydroxy-2-methoxybenzaldehyde

CAS: 66495-88-3

3-Hydroxy-2-methoxybenzaldehyde is a synthetic compound that is used as an antiviral agent. It has been shown to inhibit the replication of Coxsackievirus A9 (CV-A9). In addition, 3-Hydroxy-2-methoxybenzaldehyde reacts with isoeugenol and isonicotinic acid under acidic conditions to form 4-allyl-2-methoxyphenol, which has antiviral activity against CV-A9. This reaction requires a catalyst, such as zinc chloride or nickel sulfate. The rate of this reaction can be increased by increasing the reaction time. 3-Hydroxy-2-methoxybenzaldehyde also inhibits the virus's ability to bind to cells and enter them, reducing its infectivity.

Formula: C₈H₈O₃

Color and Shape: Powder

Molecular weight: 152.15 g/mol

Ref: 3D-FH67917

3-Hydroxy-2-methoxybenzaldehyde

CAS: 66495-88-3

Formula: C₈H₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 152.149

Ref: 10-F464325

3-Hydroxy-2-methoxybenzaldehyde

Controlled Product

CAS: 66495-88-3

Formula: C₈H₈O₃

Color and Shape: Neat

Molecular weight: 152.147

Ref: TR-H825420

3-Hydroxy-2-methoxybenzaldehyde-d3

Controlled Product

CAS: 66495-88-3

Formula: C₈H₅D₃O₃

Color and Shape: Neat

Molecular weight: 152.147

Ref: TR-H825422