
CAS 664993-53-7
:JW55
Description:
JW55, with the CAS number 664993-53-7, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a small molecule and is known to act as a selective inhibitor of certain biological pathways, which may contribute to its efficacy in treating specific diseases. The compound's structure typically includes functional groups that enhance its solubility and bioavailability, making it suitable for pharmacological studies. JW55 has been investigated for its role in modulating cellular processes, and its mechanism of action often involves interactions with specific proteins or enzymes. As with many experimental compounds, ongoing research is essential to fully elucidate its pharmacodynamics, pharmacokinetics, and potential side effects. Safety and efficacy profiles are critical for any therapeutic candidate, and JW55 is no exception, requiring thorough evaluation in preclinical and clinical settings before any potential clinical application.
Formula:C25H26N2O5
InChI:InChI=1S/C25H26N2O5/c1-30-21-10-6-19(7-11-21)25(12-15-31-16-13-25)17-26-23(28)18-4-8-20(9-5-18)27-24(29)22-3-2-14-32-22/h2-11,14H,12-13,15-17H2,1H3,(H,26,28)(H,27,29)
InChI key:ZJZWZIXSGNFWQQ-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)C2(CCOCC2)CNC(=O)C3=CC=C(C=C3)NC(=O)C4=CC=CO4
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
JW 55
CAS:JW 55 (JW55) is an effective and selective β-catenin signaling pathway inhibitor, works by inhibition of the PARP domain of tankyrase 1 and tankyrase 2 (TNKS1/2Formula:C25H26N2O5Purity:99.31% - 99.76%Color and Shape:SolidMolecular weight:434.4843N-(4-(((4-(4-Methoxyphenyl)tetrahydro-2H-pyran-4-yl)methyl)carbamoyl)phenyl)furan-2-carboxamide
CAS:Purity:≥98%Molecular weight:434.4920044Tankyrase1/2 Inhibitor IV, JW55
CAS:JW55 is a pluripotent cell compound that has been shown to inhibit tankyrase1/2 in vitro. This inhibition leads to the promotion of eye disorders, such as retinal degeneration and age-related macular degeneration. JW55 also inhibits β-catenin, which plays an important role in the regulation of cellular processes such as proliferation and differentiation. JW55 has been found to have a potential drug target for body mass index (BMI) and amyloid protein, which are associated with diseases such as Alzheimer's Disease. It is believed that JW55 may be able to bind with hydrogen bonds or polymerase chain reactions (PCRs) for natural compounds.
Formula:C25H26N2O5Purity:Min. 95%Molecular weight:434.48 g/mol





