CymitQuimica logo

CAS 66500-55-8

:

1,4-Dioxaspiro[4.5]decane-8-carboxylic acid

Description:
1,4-Dioxaspiro[4.5]decane-8-carboxylic acid is a bicyclic organic compound characterized by its unique spiro structure, which consists of a dioxane ring fused to a decane framework. This compound features two ether oxygen atoms in its dioxane moiety and a carboxylic acid functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the carboxylic acid group allows for hydrogen bonding and enhances solubility in polar solvents. Its spiro configuration imparts rigidity to the molecular structure, which can influence its physical properties, such as melting and boiling points, as well as its reactivity in chemical reactions. The compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Additionally, its unique structure can serve as a scaffold for the development of new materials or pharmaceuticals. Overall, 1,4-Dioxaspiro[4.5]decane-8-carboxylic acid represents a fascinating example of complex organic chemistry with potential utility in various fields.
Formula:C9H14O4
InChI:InChI=1S/C9H14O4/c10-8(11)7-1-3-9(4-2-7)12-5-6-13-9/h7H,1-6H2,(H,10,11)
InChI key:InChIKey=YMEMAALYLSKCLM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCC2(CC1)OCCO2
Synonyms:
  • 1,4-Dioxaspiro[4.5]decane-8-carboxylic acid
Found 4 products.