CAS 66504-82-3
:(1S,5R)-5-(p-tolyl)-3-azabicyclo[3.1.0]hexane hydrochloride
Description:
(1S,5R)-5-(p-tolyl)-3-azabicyclo[3.1.0]hexane hydrochloride is a bicyclic compound characterized by its unique structural framework, which includes a nitrogen atom incorporated into a bicyclic system. This compound features a p-tolyl group, which is a para-substituted toluene moiety, contributing to its hydrophobic characteristics and potential interactions in biological systems. The presence of the hydrochloride salt form indicates that it is a hydrochloride salt, which typically enhances solubility in water and may influence its pharmacokinetic properties. The stereochemistry denoted by (1S,5R) suggests specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and receptor interactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. Its unique bicyclic structure and functional groups may also provide avenues for further chemical modifications to enhance efficacy or reduce side effects in therapeutic applications.
Formula:C12H16ClN
InChI:InChI=1/C12H15N.ClH/c1-9-2-4-10(5-3-9)12-6-11(12)7-13-8-12;/h2-5,11,13H,6-8H2,1H3;1H/t11-,12+;/m1./s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(+)-Bicifadine Hydrochloride
CAS:Controlled ProductFormula:C12H15N·HClColor and Shape:NeatMolecular weight:209.715(+)-Bicifadine hydrochloride
CAS:Bicifadine hydrochloride is a crystalline form of (+)-bicifadine, which is an analgesic drug that has been shown to be effective in treating acute and chronic pain. The polymorphic form of bicifadine hydrochloride has a more stable structure than the polymorphic form of bicifadine, making it more suitable for oral administration. Bicifadine hydrochloride may be used for the treatment of neuropathic and functional impairment due to chronic pain and acute pain.Formula:C12H15N•HClPurity:Min. 95%Molecular weight:209.71 g/mol

