CAS 66508-19-8
:Diethyl P-[3-(hydroxyamino)propyl]phosphonate
Description:
Diethyl P-[3-(hydroxyamino)propyl]phosphonate, with the CAS number 66508-19-8, is a chemical compound that belongs to the class of phosphonates. It features a phosphonate group, which is characterized by a phosphorus atom bonded to an oxygen atom and two ethyl groups, along with a hydroxyamino substituent on a propyl chain. This structure imparts unique properties, including potential reactivity due to the presence of the hydroxyamino group, which can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The compound may exhibit moderate to high solubility in polar solvents due to its functional groups. Additionally, its phosphonate moiety suggests potential applications in agriculture as a pesticide or herbicide, as well as in medicinal chemistry for developing pharmaceuticals. Safety and handling precautions should be observed, as with many organophosphorus compounds, due to potential toxicity and environmental impact. Overall, Diethyl P-[3-(hydroxyamino)propyl]phosphonate is a versatile compound with applications in various fields of chemistry.
Formula:C7H18NO4P
InChI:InChI=1S/C7H18NO4P/c1-3-11-13(10,12-4-2)7-5-6-8-9/h8-9H,3-7H2,1-2H3
InChI key:InChIKey=HBMJDPGVDSHYBA-UHFFFAOYSA-N
SMILES:P(CCCNO)(OCC)(OCC)=O
Synonyms:- Diethyl P-[3-(hydroxyamino)propyl]phosphonate
- Phosphonic acid, [3-(hydroxyamino)propyl]-, diethyl ester
- Phosphonic acid, P-[3-(hydroxyamino)propyl]-, diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Diethyl 3-(N-Hydroxyamino)propylphosphate
CAS:Controlled ProductApplications Diethyl 3-(N-Hydroxyamino)propylphosphate (cas# 66508-19-8) is a compound useful in organic synthesis.
Formula:C7H18NO5PColor and Shape:Light YellowMolecular weight:227.2
