CAS 66508-53-0
:P-[3-(Formylhydroxyamino)propyl]phosphonic acid
Description:
P-[3-(Formylhydroxyamino)propyl]phosphonic acid, identified by its CAS number 66508-53-0, is a phosphonic acid derivative characterized by the presence of a phosphonic acid group and a side chain containing a formylhydroxyamino moiety. This compound typically exhibits properties associated with phosphonic acids, such as high solubility in polar solvents and the ability to form stable complexes with metal ions. The presence of the formyl and hydroxyamino groups suggests potential reactivity, particularly in forming covalent bonds with biological molecules, which may be relevant in biochemical applications. Additionally, the structure indicates that it may participate in hydrogen bonding due to the hydroxyl group, influencing its interactions in various environments. Its unique functional groups may also impart specific biological activities, making it of interest in pharmaceutical and agricultural research. Overall, this compound's characteristics make it a valuable subject for studies related to its chemical behavior and potential applications in various fields.
Formula:C4H10NO5P
InChI:InChI=1S/C4H10NO5P/c6-4-5(7)2-1-3-11(8,9)10/h4,7H,1-3H2,(H2,8,9,10)
InChI key:InChIKey=GJXWDTUCERCKIX-UHFFFAOYSA-N
SMILES:C(CCP(=O)(O)O)N(C=O)O
Synonyms:- (3-(Formylhydroxyamino)propyl)phosphonic acid, monosodium salt
- (3-(N-Hydroxyformamido)propyl)phosphonic acid
- Antibiotic FR 31705
- Fosmidomycin [INN]
- Fosmidomycina
- Fosmidomycina [INN-Spanish]
- Fosmidomycine
- Fosmidomycine [INN-French]
- Fosmidomycinum
- Fosmidomycinum [INN-Latin]
- P-[3-(Formylhydroxyamino)propyl]phosphonic acid
- Phosphonic acid, P-[3-(formylhydroxyamino)propyl]-
- Phosphonic acid, [3-(formylhydroxyamino)propyl]-
- Unii-5829E3D9I9
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Fosmidomycin sodium hydrate
CAS:Fosmidomycin sodium hydrate is an antibiotic, which is a natural product derived from Streptomyces lavendulae. This compound specifically inhibits the non-mevalonate pathway of isoprenoid biosynthesis by targeting 1-deoxy-D-xylulose 5-phosphate reductoisomerase (DXR), an essential enzyme in the pathway. By disrupting this process, fosmidomycin effectively impedes the synthesis of essential isoprenoid precursors, which are crucial for the survival and proliferation of certain bacteria and parasites.Formula:C4H10NO5PPurity:Min. 95%Molecular weight:183.1 g/mol
