CAS 66516-65-2

[(2-chlorobenzyl)sulfanyl]acetic acid

Description:

[(2-chlorobenzyl)sulfanyl]acetic acid, with the CAS number 66516-65-2, is an organic compound characterized by the presence of a sulfanyl (thioether) functional group and a carboxylic acid group. This compound features a 2-chlorobenzyl moiety, which contributes to its chemical reactivity and potential biological activity. The presence of the chlorine atom on the benzyl ring can influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. The sulfanyl group introduces a sulfur atom, which can participate in various chemical reactions, including nucleophilic substitutions and redox processes. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in acid-base reactions. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, [(2-chlorobenzyl)sulfanyl]acetic acid is of interest in medicinal chemistry and organic synthesis due to its unique structural features and potential applications.

Formula: C₉H₉ClO₂S

InChI: InChI=1/C9H9ClO2S/c10-8-4-2-1-3-7(8)5-13-6-9(11)12/h1-4H,5-6H2,(H,11,12)

SMILES: c1ccc(c(c1)CSCC(=O)O)Cl

Synonyms:

• Acetic Acid, 2-[[(2-Chlorophenyl)Methyl]Thio]-

[(2-Chlorobenzyl)thio]acetic acid

CAS: 66516-65-2

Versatile small molecule scaffold

Formula: C₉H₉ClO₂S

Purity: Min. 95%

Molecular weight: 216.68 g/mol

Ref: 3D-RCA51665