CAS 6653-71-0
:2-Bromo-N-(phenylmethyl)propanamide
Description:
2-Bromo-N-(phenylmethyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a bromine atom at the second carbon position of the propanamide structure contributes to its reactivity and potential applications in organic synthesis. The phenylmethyl group, also known as a benzyl group, enhances the compound's lipophilicity and can influence its biological activity. This compound typically appears as a solid or liquid, depending on the specific conditions, and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in chemical synthesis. The bromine substituent can facilitate nucleophilic substitution reactions, making it a valuable building block in the synthesis of more complex molecules. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed.
Formula:C10H12BrNO
InChI:InChI=1S/C10H12BrNO/c1-8(11)10(13)12-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,13)
InChI key:InChIKey=TVHQJFAUJYBAAE-UHFFFAOYSA-N
SMILES:C(NC(C(Br)C)=O)C1=CC=CC=C1
Synonyms:- 2-Bromo-N-(phenylmethyl)propanamide
- Propionamide, N-benzyl-2-bromo-
- propanamide, 2-bromo-N-(phenylmethyl)-
- α-Bromo-N-benzylpropionamide
- N-Benzyl-2-bromopropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

