CAS 6653-96-9

imidazo[1,2-b]pyridazin-6-amine

Description:

Imidazo[1,2-b]pyridazin-6-amine is a heterocyclic organic compound characterized by its fused imidazole and pyridazine rings. This compound typically exhibits a planar structure, which contributes to its potential interactions in biological systems. It is known for its role in medicinal chemistry, often serving as a scaffold for the development of various pharmaceuticals due to its ability to interact with biological targets. The presence of the amino group at the 6-position enhances its solubility and reactivity, making it a versatile building block in organic synthesis. Imidazo[1,2-b]pyridazin-6-amine may exhibit a range of biological activities, including antimicrobial and anticancer properties, depending on the substituents attached to the core structure. Its chemical stability and reactivity can be influenced by the electronic properties of the substituents, making it a subject of interest in drug design and development. Overall, this compound represents a significant area of research in the field of medicinal chemistry and material science.

Formula: C₆H₆N₄

InChI: InChI=1/C6H6N4/c7-5-1-2-6-8-3-4-10(6)9-5/h1-4H,(H2,7,9)

SMILES: c1cc2nccn2[nH]c1=N

Synonyms:

• Imidazo[1,2-b]pyridazin-6-amine

Imidazo[1,2-b]pyridazin-6-amine

CAS: 6653-96-9

Formula: C₆H₆N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.1386

Ref: IN-DA006KQU

Imidazo[1,2-b]pyridazin-6-amine

CAS: 6653-96-9

Imidazo[1,2-b]pyridazin-6-amine

Purity: 98%

Molecular weight: 134.14g/mol

Ref: 54-OR74764

Imidazo[1,2-b]pyridazin-6-amine

CAS: 6653-96-9

Formula: C₆H₆N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 134.142

Ref: 10-F076314