CAS 66533-64-0

Pyrazinecarboxylic acid, 6-(ethylthio)-

Description:

Pyrazinecarboxylic acid, 6-(ethylthio)-, is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a carboxylic acid functional group (-COOH) contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The ethylthio group (-S-ethyl) at the 6-position of the pyrazine ring introduces a sulfur atom, which can influence the compound's electronic properties and reactivity. This compound may exhibit polar characteristics due to the carboxylic acid and thioether functionalities, affecting its solubility in different solvents. Additionally, the presence of both nitrogen and sulfur atoms in the structure can impart unique biological activities, making it of interest in pharmaceutical and agrochemical research. Overall, pyrazinecarboxylic acid, 6-(ethylthio)-, is a versatile compound with potential applications in various fields, including organic synthesis and medicinal chemistry.

Formula: C₇H₈N₂O₂S

InChI: InChI=1/C7H8N2O2S/c1-2-12-6-4-8-3-5(9-6)7(10)11/h3-4H,2H2,1H3,(H,10,11)

SMILES: CCSc1cncc(C(=O)O)n1

Synonyms:

• 6-(Ethylthio)-pyrazinecarboxylic acid
• 6-(Ethylsulfanyl)Pyrazine-2-Carboxylic Acid

6-(Ethylsulfanyl)pyrazine-2-carboxylic acid

CAS: 66533-64-0

Versatile small molecule scaffold

Formula: C₇H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 184.22 g/mol

Ref: 3D-RCA53364