CAS 66537-39-1

(2S)-2,6,10,10-tetramethyl-1-oxaspiro[4.5]dec-6-ene

Description:

(2S)-2,6,10,10-tetramethyl-1-oxaspiro[4.5]dec-6-ene is a chemical compound characterized by its unique spirocyclic structure, which features a spiro linkage between two rings. The presence of the oxaspiro moiety indicates that it contains an oxygen atom within the spiro framework, contributing to its reactivity and potential applications in organic synthesis. The compound has multiple methyl groups, which can influence its steric and electronic properties, making it relatively bulky and potentially affecting its solubility and boiling point. The stereochemistry denoted by (2S) suggests that it has a specific three-dimensional arrangement, which can be crucial for its biological activity or interaction with other molecules. This compound may be of interest in fields such as medicinal chemistry, materials science, or fragrance chemistry due to its structural features. Its CAS number, 66537-39-1, allows for easy identification and retrieval of information regarding its properties, safety data, and potential applications in various chemical contexts.

Formula: C₁₃H₂₂O

InChI: InChI=1/C13H22O/c1-10-6-5-8-12(3,4)13(10)9-7-11(2)14-13/h6,11H,5,7-9H2,1-4H3/t11-,13?/m0/s1

SMILES: CC1=CCCC(C)(C)C21CC[C@H](C)O2

Theaspirane A

CAS: 66537-39-1

Formula: C₁₃H₂₂O

Molecular weight: 194.32

Ref: 4Z-T-299002

(+)-Theaspirane A

Controlled Product

CAS: 66537-39-1

Formula: C₁₃H₂₂O

Color and Shape: Neat

Molecular weight: 194.313

Ref: TR-T986140