CAS 6654-64-4

1,3,5-Naphthalenetrisulfonic acid

Description:

1,3,5-Naphthalenetrisulfonic acid is an aromatic sulfonic acid characterized by the presence of three sulfonic acid groups (-SO3H) attached to a naphthalene ring at the 1, 3, and 5 positions. This compound is typically a white to light yellow solid that is soluble in water, reflecting its polar sulfonic acid groups. It exhibits strong acidic properties due to the presence of the sulfonic acid functional groups, making it useful in various applications, including as a reagent in organic synthesis and as a dyeing agent in textile industries. The compound can also act as a dispersing agent and is utilized in the formulation of certain types of inks and coatings. Its structure allows for potential interactions with other molecules, making it valuable in research and industrial applications. Additionally, 1,3,5-naphthalenetrisulfonic acid can participate in various chemical reactions, including sulfonation and electrophilic substitution, due to the reactivity of the aromatic system.

Formula: C₁₀H₈O₉S₃

InChI: InChI=1S/C10H8O9S3/c11-20(12,13)6-4-8-7(10(5-6)22(17,18)19)2-1-3-9(8)21(14,15)16/h1-5H,(H,11,12,13)(H,14,15,16)(H,17,18,19)

InChI key: InChIKey=INMHJULHWVWVFN-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C=1C2=C(C(S(=O)(=O)O)=CC(S(=O)(=O)O)=C2)C=CC1

Synonyms:

• 1,3,5-Naphthalenetrisulfonic acid
• Naphthalene-1,3,5-Trisulfonic Acid
• Naphthalene-1,3,5-trisulphonic acid

Naphthalene-1,3,5-trisulfonic acid

CAS: 6654-64-4

Formula: C₁₀H₈O₉S₃

Color and Shape: Solid

Molecular weight: 368.3601

Ref: IN-DA0035C6

Naphthalene-1,3,5-trisulphonic acid

CAS: 6654-64-4

Naphthalene-1,3,5-trisulphonic acid

Formula: C₁₀H₈O₉S₃

Purity: ≥95%

Color and Shape: white solid

Molecular weight: 368.36g/mol

Ref: 54-OR51841

1,3,5-Naphthalene trisulfonic acid

CAS: 6654-64-4

1,3,5-Naphthalene trisulfonic acid is an organic compound that is the product of the sulfonation of naphthalene. It has been shown to inhibit the activity of 3β-hydroxysteroid dehydrogenase and 17β-hydroxysteroid dehydrogenase, enzymes involved in steroidogenesis. The maximal response was observed at a concentration of 500 μM with a detection time of 30 minutes. Xenopus oocytes were used for expression and chloride currents were recorded as an indicator for enzyme activity. Concentration-response curves were generated with organic solvents such as methanol and dimethyl sulfoxide (DMSO). 1,3,5-Naphthalene trisulfonic acid also inhibits the oxidative activities of some enzymes such as lipoxygenase and cyclooxygenase.

Formula: C₁₀H₈O₉S₃

Purity: Min. 95%

Molecular weight: 368.36 g/mol

Ref: 3D-FN41564