CAS 66548-63-8

Pyridazine, 3-chloro-6-[3-(trifluoromethyl)phenyl]-

Description:

Pyridazine, 3-chloro-6-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The compound features a chlorine substituent at the 3-position and a 3-(trifluoromethyl)phenyl group at the 6-position of the pyridazine ring. The trifluoromethyl group is known for its strong electron-withdrawing properties, which can significantly influence the compound's reactivity and stability. This substance is typically used in various chemical applications, including pharmaceuticals and agrochemicals, due to its unique structural features. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. As with many halogenated compounds, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential hazards associated with this compound.

Formula: C₁₁H₆ClF₃N₂

InChI: InChI=1S/C11H6ClF3N2/c12-10-5-4-9(16-17-10)7-2-1-3-8(6-7)11(13,14)15/h1-6H

InChI key: InChIKey=TVWOBKTURBXCNX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1)C2=CC=C(Cl)N=N2

Synonyms:

• Pyridazine, 3-chloro-6-[3-(trifluoromethyl)phenyl]-
• 3-Chloro-6-[3-(trifluoromethyl)phenyl]pyridazine

3-Chloro-6-[3-(trifluoromethyl)phenyl]pyridazine

CAS: 66548-63-8

Versatile small molecule scaffold

Formula: C₁₁H₆ClF₃N₂

Purity: Min. 95%

Molecular weight: 258.62 g/mol

Ref: 3D-RCA54863