CAS 66550-09-2: Muzigadial

Description:Muzigadial, with the CAS number 66550-09-2, is a chemical compound that belongs to the class of natural products known as terpenoids. It is primarily derived from certain plant sources and is characterized by its unique molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Muzigadial has been studied for its potential pharmacological properties, including anti-inflammatory and antimicrobial effects. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many terpenoids, it may exhibit a range of biological activities, making it of interest in medicinal chemistry and natural product research. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe usage in laboratory or industrial settings. Further research is often necessary to fully understand its mechanisms of action and potential applications in various fields, including pharmaceuticals and agriculture.

Formula:C₁₅H₂₀O₃

InChI:InChI=1S/C15H20O3/c1-10-6-7-14(3)13(11(10)2)5-4-12(8-16)15(14,18)9-17/h4,8-10,13,18H,2,5-7H2,1,3H3/t10-,13-,14-,15+/m0/s1

InChI key:InChIKey=LDAIOVKPAKFZHM-FBUXBERBSA-N

SMILES:O=CC1=CCC2C(=C)C(C)CCC2(C)C1(O)C=O

Synonyms:
1,2-Naphthalenedicarboxaldehyde, 1,4,4a,5,6,7,8,8a-octahydro-1-hydroxy-6,8a-dimethyl-5-methylene-, (1S,4aS,6S,8aS)-
(1S,4aS,6S,8aS)-1,4,4a,5,6,7,8,8a-Octahydro-1-hydroxy-6,8a-dimethyl-5-methylene-1,2-naphthalenedicarboxaldehyde
1,2-Naphthalenedicarboxaldehyde, 1,4,4a,5,6,7,8,8a-octahydro-1-hydroxy-6,8a-dimethyl-5-methylene-, [1S-(1α,4aα,6β,8aβ)]-
Muzigadial
Canellal