CAS 66569-27-5

Sparfosate sodium

Description:

Sparfosate sodium, with the CAS number 66569-27-5, is a chemical compound primarily used as a herbicide. It belongs to the class of phosphonic acid derivatives and is known for its ability to inhibit certain enzymes involved in the biosynthesis of amino acids in plants, thereby affecting their growth and development. Sparfosate sodium is typically characterized by its solubility in water, which facilitates its application in agricultural settings. The compound is often utilized in the control of various weeds and unwanted vegetation, making it valuable in crop management. Its mode of action is selective, targeting specific plant species while minimizing impact on others, which is crucial for sustainable agricultural practices. Additionally, safety assessments and environmental impact studies are essential for understanding its behavior in ecosystems, as with any herbicide. Overall, Sparfosate sodium represents a significant tool in modern agriculture, contributing to effective weed management strategies.

Formula: C₆H₁₀NO₈P·2Na

InChI: InChI=1S/C6H10NO8P.2Na/c8-4(2-16(13,14)15)7-3(6(11)12)1-5(9)10;;/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12)(H2,13,14,15);;/t3-;;/m0../s1

InChI key: InChIKey=RTYSAXWKNRLLQU-QTNFYWBSSA-N

SMILES: [C@H](NC(CP(=O)(O)O)=O)(CC(O)=O)C(O)=O.[Na]

Synonyms:

• L-Aspartic acid, N-(phosphonoacetyl)-, disodium salt
• CI 882
• Sparfosate sodium
• L-Aspartic acid, N-(2-phosphonoacetyl)-, sodium salt (1:2)

Sparfosate sodium

CAS: 66569-27-5

Sparfloxacin is a peptide that is used as a research tool in cell biology and pharmacology. It binds to the anti-sigma factor, which is involved in the regulation of ribosomal RNA (rRNA) synthesis. This binding prevents the formation of an rRNA transcription complex with the 50S ribosomal subunit, inhibiting protein synthesis and cell division. Sparfloxacin can also inhibit ion channels by binding to their ligand-binding sites, reducing the flow of ions through these channels.

Formula: C₆H₈NNa₂O₈P

Purity: Min. 95%

Molecular weight: 299.08 g/mol

Ref: 3D-RCA56927