CAS 66572-56-3
:2-Bromoisonicotinic acid
Description:
2-Bromoisonicotinic acid is a chemical compound that belongs to the class of heterocyclic aromatic compounds, specifically a derivative of pyridine. It features a bromine atom substituted at the 2-position of the isonicotinic acid structure, which is characterized by a pyridine ring with a carboxylic acid group at the 4-position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. Its molecular structure contributes to its potential applications in pharmaceuticals and organic synthesis, particularly in the development of biologically active compounds. The presence of the bromine atom can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 2-bromoisonicotinic acid may exhibit biological activities, which can be explored in medicinal chemistry. As with many chemical substances, proper handling and safety precautions are essential due to its potential hazards.
Formula:C6H3BrNO2
InChI:InChI=1/C6H4BrNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10)/p-1
SMILES:c1cnc(cc1C(=O)[O-])Br
Synonyms:- 2-Bromopyridine-4-carboxylic acid
- 2-Bromo-4-Pyridine Carboxylic Acid
- 4-Pyridinecarboxylic acid, 2-bromo-
- 2-Bromopyridine-4-Carboxylate
- 2-Bromo-4-pyridinecorboxylc
- 2-Bromo-4-pyridinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromoisonicotinic Acid
CAS:Formula:C6H4BrNO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:202.012-Bromoisonicotinic acid
CAS:Formula:C6H4BrNO2Purity:98%Color and Shape:SolidMolecular weight:202.0055Ref: IN-DA003GS1
1kgTo inquire1g20.00€5g29.00€10g31.00€25g57.00€50g86.00€100g136.00€250g224.00€500g586.00€2-Bromoisonicotinic acid
CAS:2-Bromoisonicotinic acidFormula:C6H4BrNO2Purity:98%Color and Shape: white to off white solidMolecular weight:202.00546g/mol2-Bromo-4-pyridinecarboxylic acid
CAS:Formula:C6H4BrNO2Purity:98%Color and Shape:SolidMolecular weight:202.0072-Bromoisonicotinic acid
CAS:2-Bromoisonicotinic acid is a phenylpyridine molecule that has been shown to have inhibitory activity against the NF-κB pathway, which regulates inflammatory responses. This compound inhibits the production of TNF-α triggered by lipopolysaccharide (LPS) in vitro and in vivo. 2-Bromoisonicotinic acid may be synthesized from commercially available starting materials and can be easily scaled up for large-scale synthesis. The properties of this molecule make it an excellent candidate for further investigation as a potential therapeutic or prophylactic agent for diseases involving inflammation.Purity:Min. 95%




