CymitQuimica logo

CAS 66582-32-9

:

1-Propanol, 2,2-dimethyl-3-(phenylmethoxy)-

Description:
1-Propanol, 2,2-dimethyl-3-(phenylmethoxy)-, also known by its CAS number 66582-32-9, is an organic compound characterized by its structure, which includes a propanol backbone with additional functional groups. This compound features a phenylmethoxy group, which contributes to its unique chemical properties. It is typically a colorless liquid with a moderate boiling point and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic phenyl group. The presence of the alcohol functional group (-OH) allows for hydrogen bonding, influencing its reactivity and interactions with other substances. This compound may be used in various applications, including as a solvent or in the synthesis of other chemical compounds. Its specific characteristics, such as viscosity, density, and reactivity, can vary based on environmental conditions and the presence of other chemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H18O2
InChI:InChI=1S/C12H18O2/c1-12(2,9-13)10-14-8-11-6-4-3-5-7-11/h3-7,13H,8-10H2,1-2H3
InChI key:SGGGHAPHBMPBBV-UHFFFAOYSA-N
SMILES:CC(C)(CO)COCC1=CC=CC=C1
Found 5 products.