CymitQuimica logo

CAS 66584-31-4

:

3-Methoxy-5-methyl-phenylamine

Description:
3-Methoxy-5-methyl-phenylamine, also known by its CAS number 66584-31-4, is an organic compound characterized by the presence of an amine functional group attached to a phenyl ring that is further substituted with a methoxy group and a methyl group. This compound typically appears as a colorless to light yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit limited solubility in water due to the hydrophobic nature of the aromatic ring. The presence of the methoxy and methyl groups can influence its reactivity and interaction with other chemical species, making it of interest in various chemical syntheses and applications. Additionally, 3-Methoxy-5-methyl-phenylamine may exhibit biological activity, which could be relevant in pharmaceutical research. As with many amines, it may have basic properties and can participate in various chemical reactions, including alkylation and acylation, making it a versatile building block in organic synthesis. Safety precautions should be taken when handling this compound, as with all chemical substances.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c1-6-3-7(9)5-8(4-6)10-2/h3-5H,9H2,1-2H3
InChI key:SIYIMMXOEYEZHK-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1)OC)N
Found 4 products.