CAS 66592-75-4

Glycine, N-(N-threonylglycyl)-

Description:

Glycine, N-(N-threonylglycyl)-, with the CAS number 66592-75-4, is a synthetic compound that belongs to the class of peptides. It is characterized by its structure, which includes glycine and threonylglycine moieties, contributing to its unique properties. This compound is typically soluble in water, making it suitable for various biochemical applications. As a peptide, it may exhibit biological activity, potentially influencing metabolic processes or serving as a building block for larger proteins. Its molecular interactions can be influenced by the presence of functional groups, such as amino and hydroxyl groups, which are inherent in its structure. Glycine, being the simplest amino acid, contributes to the overall stability and reactivity of the compound. The specific characteristics, such as melting point, boiling point, and reactivity, can vary based on the conditions under which the substance is studied. Overall, Glycine, N-(N-threonylglycyl)- is of interest in fields such as biochemistry, pharmacology, and materials science due to its potential applications in drug development and protein synthesis.

Formula: C₈H₁₅N₃O₅

InChI: InChI=1/C8H15N3O5/c1-4(12)7(9)8(16)11-2-5(13)10-3-6(14)15/h4,7,12H,2-3,9H2,1H3,(H,10,13)(H,11,16)(H,14,15)/t4-,7+/s2

InChI key: InChIKey=XPNSAQMEAVSQRD-OHAROVNANA-N

SMILES: C(NCC(NCC(O)=O)=O)([C@H]([C@@H](C)O)N)=O

Synonyms:

• Glycine, N-(N-threonylglycyl)-
• Glycine, N-(N-DL-threonylglycyl)-

Thr-Gly-Gly-OH

CAS: 66592-75-4

Formula: C₈H₁₅N₃O₅

Purity: 99.0%

Molecular weight: 233.224

Ref: 10-F493139

H-Thr-Gly-Gly-OH

CAS: 66592-75-4

Please enquire for more information about H-Thr-Gly-Gly-OH including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₈H₁₅N₃O₅

Purity: Min. 95%

Molecular weight: 233.22 g/mol

Ref: 3D-FT109438