CymitQuimica logo

CAS 666-08-0

:

2-azaspiro[3,5]nonane

Description:
2-Azaspiro[3,5]nonane, with the CAS number 666-08-0, is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom incorporated into a nonane framework. This compound features a spiro connection between two rings, contributing to its rigidity and three-dimensional shape. It is a colorless to pale yellow liquid at room temperature and has a distinctive amine-like odor. The presence of the nitrogen atom in its structure imparts basic properties, making it a potential candidate for various chemical reactions, including alkylation and acylation. 2-Azaspiro[3,5]nonane is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Its solubility in organic solvents and relatively low volatility make it suitable for various synthetic processes. However, safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H15N
InChI:InChI=1/C8H15N/c1-2-4-8(5-3-1)6-9-7-8/h9H,1-7H2
SMILES:C1CCC2(CC1)CNC2
Synonyms:
  • 2-Azaspiro[3.5]nonan
  • 2-Azaspiro[3.5]nonane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.