CAS 66611-15-2
:1-(1-benzofuran-3-yl)ethanone
Description:
1-(1-benzofuran-3-yl)ethanone, also known by its CAS number 66611-15-2, is an organic compound characterized by the presence of a benzofuran moiety attached to an ethanone functional group. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It has a molecular formula that reflects its structure, which includes a benzofuran ring—a fused bicyclic structure containing both a benzene and a furan ring. The ethanone group contributes to its reactivity, particularly in electrophilic substitution reactions. This compound may exhibit various physical properties such as solubility in organic solvents and moderate stability under standard conditions. Its potential applications can span across fields such as organic synthesis, medicinal chemistry, and materials science, where it may serve as an intermediate or a building block for more complex molecules. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.
Formula:C10H8O2
InChI:InChI=1/C10H8O2/c1-7(11)9-6-12-10-5-3-2-4-8(9)10/h2-6H,1H3
SMILES:CC(=O)c1coc2ccccc12
Synonyms:- Ethanone, 1-(3-benzofuranyl)-
- 1-(1-Benzofuran-3-yl)ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(1-Benzofuran-3-yl)ethanone
CAS:Controlled ProductFormula:C10H8O2Color and Shape:NeatMolecular weight:160.1693-Acetylbenzo[b]furan
CAS:3-Acetylbenzo[b]furan is a potent inhibitor of lipase and other enzymes. It has been shown to inhibit acetaldehyde dehydrogenase, an enzyme that catalyzes the conversion of acetaldehyde to acetic acid. 3-Acetylbenzo[b]furan also inhibits chemoenzymatic reactions and has a potent inhibitory activity against asymmetric synthesis. This compound has been shown to be useful for the production of chiral compounds with high selectivities. 3-Acetylbenzo[b]furan can be used as a ligand and isomeric in various fluorescent assays.
Formula:C10H8O2Purity:Min. 95%Molecular weight:160.17 g/mol




