CAS 66611-38-9

N-[2-Hydroxy-3-(1-piperidinyl)propoxy]-3-pyridinecarboximidamide

Description:

N-[2-Hydroxy-3-(1-piperidinyl)propoxy]-3-pyridinecarboximidamide, identified by its CAS number 66611-38-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a piperidine moiety, and a carboximidamide functional group. This compound typically exhibits properties associated with both amides and alcohols, such as potential solubility in polar solvents due to the presence of hydroxyl and amine groups. Its molecular structure suggests it may engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. The presence of the piperidine ring may impart certain pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's ability to form various derivatives could be explored for applications in drug development or as a biochemical probe. Overall, while specific physical and chemical properties such as melting point, boiling point, and solubility may vary, the compound's functional groups play a crucial role in determining its behavior in chemical reactions and biological interactions.

Formula: C₁₄H₂₂N₄O₂

InChI: InChI=1S/C14H22N4O2/c15-14(12-5-4-6-16-9-12)17-20-11-13(19)10-18-7-2-1-3-8-18/h4-6,9,13,19H,1-3,7-8,10-11H2,(H2,15,17)

InChI key: InChIKey=MVLOQULXIYSERZ-UHFFFAOYSA-N

SMILES: C(C(CONC(=N)C=1C=CC=NC1)O)N2CCCCC2

Synonyms:

• NP 51
• N-[2-Hydroxy-3-(1-piperidinyl)propoxy]-3-pyridinecarboximidamide
• 3-Pyridinecarboximidamide, N-[2-hydroxy-3-(1-piperidinyl)propoxy]-
• (±)-O-(3-Piperidino-2-hydroxy-1-propyl)nicotinic acid amidoxime

N-(2-Hydroxy-3-(1-piperidinyl)propoxy)-3-pyridinecarboximidamide

CAS: 66611-38-9

Please enquire for more information about N-(2-Hydroxy-3-(1-piperidinyl)propoxy)-3-pyridinecarboximidamide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₂₂N₄O₂

Purity: Min. 95%

Molecular weight: 278.35 g/mol

Ref: 3D-RCA61138